C19H21ClN6O2 — CID 121074526
2-(4-chlorophenoxy)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 121074526) has the molecular formula C19H21ClN6O2 and a molecular weight of 400.87 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 121074526 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | Cc1nc(NCCNC(=O)COc2ccc(Cl)cc2)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C19H21ClN6O2/c1-13-24-17(11-18(25-13)26-10-9-21-14(26)2)22-7-8-23-19(27)12-28-16-5-3-15(20)4-6-16/h3-6,9-11H,7-8,12H2,1-2H3,(H,23,27)(H,22,24,25) |
| InChIKey | PLSNJLAACFWKRC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|