C19H21FN6O — CID 121074532
2-(4-fluorophenyl)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 121074532) has the molecular formula C19H21FN6O and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 121074532 |
| Molecular Formula | C19H21FN6O |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | Cc1nc(NCCNC(=O)Cc2ccc(F)cc2)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C19H21FN6O/c1-13-24-17(12-18(25-13)26-10-9-21-14(26)2)22-7-8-23-19(27)11-15-3-5-16(20)6-4-15/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,23,27)(H,22,24,25) |
| InChIKey | XXMABXAWTDCRFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|