C15H18N8OS — CID 121074529
4-methyl-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiadiazole-5-carboxamide (PubChem CID 121074529) has the molecular formula C15H18N8OS and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-methyl-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121074529 |
| Molecular Formula | C15H18N8OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-methyl-N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiadiazole-5-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2snnc2C)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C15H18N8OS/c1-9-14(25-22-21-9)15(24)18-5-4-17-12-8-13(20-10(2)19-12)23-7-6-16-11(23)3/h6-8H,4-5H2,1-3H3,(H,18,24)(H,17,19,20) |
| InChIKey | ASZDSIJIBLDYEM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|