C18H18F3N7O — CID 122291051
1-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 122291051) has the molecular formula C18H18F3N7O and a molecular weight of 405.38 g/mol. Its IUPAC name is 1-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 122291051 |
| Molecular Formula | C18H18F3N7O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccc(F)c(F)c2F)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C18H18F3N7O/c1-10-25-14(9-15(26-10)28-8-7-22-11(28)2)23-5-6-24-18(29)27-13-4-3-12(19)16(20)17(13)21/h3-4,7-9H,5-6H2,1-2H3,(H,23,25,26)(H2,24,27,29) |
| InChIKey | JELSQNJGZHPMME-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|