C18H17ClF3N7O — CID 121074231
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 121074231) has the molecular formula C18H17ClF3N7O and a molecular weight of 439.83 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121074231 |
| Molecular Formula | C18H17ClF3N7O |
| Molecular Weight | 439.83 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C18H17ClF3N7O/c1-11-23-6-7-29(11)16-9-15(26-10-27-16)24-4-5-25-17(30)28-12-2-3-14(19)13(8-12)18(20,21)22/h2-3,6-10H,4-5H2,1H3,(H,24,26,27)(H2,25,28,30) |
| InChIKey | RLANEPBVLSIITD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|