C19H19ClN6O — CID 122290942
(E)-3-(4-chlorophenyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 122290942) has the molecular formula C19H19ClN6O and a molecular weight of 382.86 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122290942 |
| Molecular Formula | C19H19ClN6O |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)/C=C/c2ccc(Cl)cc2)ncn1 |
| InChI | InChI=1S/C19H19ClN6O/c1-14-21-10-11-26(14)18-12-17(24-13-25-18)22-8-9-23-19(27)7-4-15-2-5-16(20)6-3-15/h2-7,10-13H,8-9H2,1H3,(H,23,27)(H,22,24,25)/b7-4+ |
| InChIKey | ZGPOJCLBFZGLBY-QPJJXVBHSA-N |
| XLogP | 2.87 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|