C20H19ClF3N7O — CID 122315010
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 122315010) has the molecular formula C20H19ClF3N7O and a molecular weight of 465.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122315010 |
| Molecular Formula | C20H19ClF3N7O |
| Molecular Weight | 465.87 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C20H19ClF3N7O/c1-12-28-17(11-18(29-12)31-16-4-2-3-7-25-16)26-8-9-27-19(32)30-13-5-6-15(21)14(10-13)20(22,23)24/h2-7,10-11H,8-9H2,1H3,(H2,27,30,32)(H2,25,26,28,29,31) |
| InChIKey | SVXVBTPQJGCIBN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|