C17H23ClN6O — CID 121074936
1-(3-chloro-4-methylphenyl)-3-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]urea (PubChem CID 121074936) has the molecular formula C17H23ClN6O and a molecular weight of 362.87 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121074936 |
| Molecular Formula | C17H23ClN6O |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
| SMILES | CCNc1cc(NCCNC(=O)Nc2ccc(C)c(Cl)c2)nc(C)n1 |
| InChI | InChI=1S/C17H23ClN6O/c1-4-19-15-10-16(23-12(3)22-15)20-7-8-21-17(25)24-13-6-5-11(2)14(18)9-13/h5-6,9-10H,4,7-8H2,1-3H3,(H2,21,24,25)(H2,19,20,22,23) |
| InChIKey | NXWCPZDPFVOTBS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|