C20H24ClN7O2 — CID 121072680
1-(3-chloro-4-methoxyphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea (PubChem CID 121072680) has the molecular formula C20H24ClN7O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121072680 |
| Molecular Formula | C20H24ClN7O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCNc2cc(-n3nc(C)cc3C)nc(C)n2)cc1Cl |
| InChI | InChI=1S/C20H24ClN7O2/c1-12-9-13(2)28(27-12)19-11-18(24-14(3)25-19)22-7-8-23-20(29)26-15-5-6-17(30-4)16(21)10-15/h5-6,9-11H,7-8H2,1-4H3,(H,22,24,25)(H2,23,26,29) |
| InChIKey | CMWFMHVVQFEIRH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|