C19H22FN7O — CID 121072684
1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-(2-fluorophenyl)urea (PubChem CID 121072684) has the molecular formula C19H22FN7O and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 121072684 |
| Molecular Formula | C19H22FN7O |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-3-(2-fluorophenyl)urea |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)Nc3ccccc3F)nc(C)n2)n1 |
| InChI | InChI=1S/C19H22FN7O/c1-12-10-13(2)27(26-12)18-11-17(23-14(3)24-18)21-8-9-22-19(28)25-16-7-5-4-6-15(16)20/h4-7,10-11H,8-9H2,1-3H3,(H,21,23,24)(H2,22,25,28) |
| InChIKey | RGMZWKKFOBHQRB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|