C21H27N7O — CID 121072688
1-(2,3-dimethylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea (PubChem CID 121072688) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121072688 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)Nc3cccc(C)c3C)nc(C)n2)n1 |
| InChI | InChI=1S/C21H27N7O/c1-13-7-6-8-18(16(13)4)26-21(29)23-10-9-22-19-12-20(25-17(5)24-19)28-15(3)11-14(2)27-28/h6-8,11-12H,9-10H2,1-5H3,(H,22,24,25)(H2,23,26,29) |
| InChIKey | UGUIZEKDPCGXGI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|