C21H26N6O2 — CID 122290113
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(2-methylphenoxy)acetamide (PubChem CID 122290113) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 122290113 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(2-methylphenoxy)acetamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)COc3ccccc3C)nc(C)n2)n1 |
| InChI | InChI=1S/C21H26N6O2/c1-14-7-5-6-8-18(14)29-13-21(28)23-10-9-22-19-12-20(25-17(4)24-19)27-16(3)11-15(2)26-27/h5-8,11-12H,9-10,13H2,1-4H3,(H,23,28)(H,22,24,25) |
| InChIKey | PYAXBALBWWSWHT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|