C21H24ClFN6O — CID 122290240
3-(3-chloro-4-fluorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]propanamide (PubChem CID 122290240) has the molecular formula C21H24ClFN6O and a molecular weight of 430.92 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]propanamide.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122290240 |
| Molecular Formula | C21H24ClFN6O |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]propanamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)CCc3ccc(F)c(Cl)c3)nc(C)n2)n1 |
| InChI | InChI=1S/C21H24ClFN6O/c1-13-10-14(2)29(28-13)20-12-19(26-15(3)27-20)24-8-9-25-21(30)7-5-16-4-6-18(23)17(22)11-16/h4,6,10-12H,5,7-9H2,1-3H3,(H,25,30)(H,24,26,27) |
| InChIKey | VGCQPNFSPHAVCB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|