C17H21ClFN5O — CID 122320904
3-(3-chloro-4-fluorophenyl)-N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]propanamide (PubChem CID 122320904) has the molecular formula C17H21ClFN5O and a molecular weight of 365.84 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]propanamide.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122320904 |
| Molecular Formula | C17H21ClFN5O |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]propanamide |
| SMILES | CN(C)c1cnnc(NCCNC(=O)CCc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H21ClFN5O/c1-24(2)13-10-16(23-22-11-13)20-7-8-21-17(25)6-4-12-3-5-15(19)14(18)9-12/h3,5,9-11H,4,6-8H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | OGEQQZBJTNVHNV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|