C15H16F3N5O — CID 122320842
N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,3,4-trifluorobenzamide (PubChem CID 122320842) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 122320842 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-2,3,4-trifluorobenzamide |
| SMILES | CN(C)c1cnnc(NCCNC(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H16F3N5O/c1-23(2)9-7-12(22-21-8-9)19-5-6-20-15(24)10-3-4-11(16)14(18)13(10)17/h3-4,7-8H,5-6H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | MARRMFSSRYYEHD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|