C16H18F3N5O — CID 122293406
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2,3,4-trifluorobenzamide (PubChem CID 122293406) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 122293406 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2,3,4-trifluorobenzamide |
| SMILES | CCNc1cc(NCCNC(=O)c2ccc(F)c(F)c2F)nc(C)n1 |
| InChI | InChI=1S/C16H18F3N5O/c1-3-20-12-8-13(24-9(2)23-12)21-6-7-22-16(25)10-4-5-11(17)15(19)14(10)18/h4-5,8H,3,6-7H2,1-2H3,(H,22,25)(H2,20,21,23,24) |
| InChIKey | NYOBSWLIAFCNPL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|