C14H13ClF2N4O — CID 56805454
N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-2,6-difluorobenzamide (PubChem CID 56805454) has the molecular formula C14H13ClF2N4O and a molecular weight of 326.73 g/mol. Its IUPAC name is N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 56805454 |
| Molecular Formula | C14H13ClF2N4O |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-2,6-difluorobenzamide |
| SMILES | Cc1nc(Cl)cc(NCCNC(=O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C14H13ClF2N4O/c1-8-20-11(15)7-12(21-8)18-5-6-19-14(22)13-9(16)3-2-4-10(13)17/h2-4,7H,5-6H2,1H3,(H,19,22)(H,18,20,21) |
| InChIKey | CZSQDSVOUYBLTM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|