C14H14F2N4O — CID 133310012
2,6-difluoro-N-[2-[(4-methylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 133310012) has the molecular formula C14H14F2N4O and a molecular weight of 292.29 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-[(4-methylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-[(4-methylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133310012 |
| Molecular Formula | C14H14F2N4O |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2,6-difluoro-N-[2-[(4-methylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1ccnc(NCCNC(=O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C14H14F2N4O/c1-9-5-6-18-14(20-9)19-8-7-17-13(21)12-10(15)3-2-4-11(12)16/h2-6H,7-8H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | DEPZUKXVOAJTJE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|