C15H17F2N5O — CID 47066717
1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea (PubChem CID 47066717) has the molecular formula C15H17F2N5O and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 47066717 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1ncccn1)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C15H17F2N5O/c16-12-3-1-4-13(17)11(12)5-8-21-15(23)22-10-9-20-14-18-6-2-7-19-14/h1-4,6-7H,5,8-10H2,(H,18,19,20)(H2,21,22,23) |
| InChIKey | NFSWHYCIZUTTFH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|