C17H24N6O2 — CID 94172073
1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea (PubChem CID 94172073) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea.
| Compound Name | 1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 94172073 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1ncccn1)NC[C@H](c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C17H24N6O2/c24-17(21-9-8-20-16-18-6-4-7-19-16)22-13-14(15-5-3-12-25-15)23-10-1-2-11-23/h3-7,12,14H,1-2,8-11,13H2,(H,18,19,20)(H2,21,22,24)/t14-/m1/s1 |
| InChIKey | KVGBMLFVNMWXGN-CQSZACIVSA-N |
| XLogP | 1.62 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|