C18H22ClN3O2 — CID 36872492
1-[(4-chlorophenyl)methyl]-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]urea (PubChem CID 36872492) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]urea |
|---|---|
| PubChem CID | 36872492 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)NC[C@@H](c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C18H22ClN3O2/c19-15-7-5-14(6-8-15)12-20-18(23)21-13-16(17-4-3-11-24-17)22-9-1-2-10-22/h3-8,11,16H,1-2,9-10,12-13H2,(H2,20,21,23)/t16-/m0/s1 |
| InChIKey | BXPMISIJQUERMD-INIZCTEOSA-N |
| XLogP | 3.57 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |