C17H27N3O3 — CID 71930287
1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[(1-hydroxycyclobutyl)methyl]urea (PubChem CID 71930287) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[(1-hydroxycyclobutyl)methyl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 71930287 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
| SMILES | O=C(NCC(c1ccco1)N1CCCCC1)NCC1(O)CCC1 |
| InChI | InChI=1S/C17H27N3O3/c21-16(19-13-17(22)7-5-8-17)18-12-14(15-6-4-11-23-15)20-9-2-1-3-10-20/h4,6,11,14,22H,1-3,5,7-10,12-13H2,(H2,18,19,21) |
| InChIKey | FAPQEISSXNHGNE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |