C16H25N3O2S — CID 97078924
1-[(1-hydroxycyclobutyl)methyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea (PubChem CID 97078924) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-[(1-hydroxycyclobutyl)methyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-[(1-hydroxycyclobutyl)methyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 97078924 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[(1-hydroxycyclobutyl)methyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea |
| SMILES | O=C(NC[C@H](c1cccs1)N1CCCC1)NCC1(O)CCC1 |
| InChI | InChI=1S/C16H25N3O2S/c20-15(18-12-16(21)6-4-7-16)17-11-13(14-5-3-10-22-14)19-8-1-2-9-19/h3,5,10,13,21H,1-2,4,6-9,11-12H2,(H2,17,18,20)/t13-/m1/s1 |
| InChIKey | DQUWZIOGBWOURE-CYBMUJFWSA-N |
| XLogP | 2.10 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |