C18H24N4O2S2 — CID 134057478
3-(carbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-thiophen-2-ylpropanamide (PubChem CID 134057478) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-thiophen-2-ylpropanamide.
| Compound Name | 3-(carbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 134057478 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-(carbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)NC(CC(=O)NCC(c1cccs1)N1CCCC1)c1cccs1 |
| InChI | InChI=1S/C18H24N4O2S2/c19-18(24)21-13(15-5-3-9-25-15)11-17(23)20-12-14(16-6-4-10-26-16)22-7-1-2-8-22/h3-6,9-10,13-14H,1-2,7-8,11-12H2,(H,20,23)(H3,19,21,24) |
| InChIKey | YJOQMVAGUHARPK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |