C20H32N4O2S — CID 134057065
3-(carbamoylamino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-thiophen-2-ylpropanamide (PubChem CID 134057065) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-thiophen-2-ylpropanamide.
| Compound Name | 3-(carbamoylamino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 134057065 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-(carbamoylamino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)NC(CC(=O)NCC1(N2CCCCC2)CCCCC1)c1cccs1 |
| InChI | InChI=1S/C20H32N4O2S/c21-19(26)23-16(17-8-7-13-27-17)14-18(25)22-15-20(9-3-1-4-10-20)24-11-5-2-6-12-24/h7-8,13,16H,1-6,9-12,14-15H2,(H,22,25)(H3,21,23,26) |
| InChIKey | MSPVPATYMGRSRZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |