C15H16N4O3S — CID 134011246
[3-(2-benzoylhydrazinyl)-3-oxo-1-thiophen-2-ylpropyl]urea (PubChem CID 134011246) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is [3-(2-benzoylhydrazinyl)-3-oxo-1-thiophen-2-ylpropyl]urea.
| Compound Name | [3-(2-benzoylhydrazinyl)-3-oxo-1-thiophen-2-ylpropyl]urea |
|---|---|
| PubChem CID | 134011246 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [3-(2-benzoylhydrazinyl)-3-oxo-1-thiophen-2-ylpropyl]urea |
| SMILES | NC(=O)NC(CC(=O)NNC(=O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H16N4O3S/c16-15(22)17-11(12-7-4-8-23-12)9-13(20)18-19-14(21)10-5-2-1-3-6-10/h1-8,11H,9H2,(H,18,20)(H,19,21)(H3,16,17,22) |
| InChIKey | GWFQTPAGZYQAAC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|