C17H21N3O2S — CID 26081925
(3R)-3-(carbamoylamino)-N-[(1R)-1-(2-methylphenyl)ethyl]-3-thiophen-2-ylpropanamide (PubChem CID 26081925) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-N-[(1R)-1-(2-methylphenyl)ethyl]-3-thiophen-2-ylpropanamide.
| Compound Name | (3R)-3-(carbamoylamino)-N-[(1R)-1-(2-methylphenyl)ethyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 26081925 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (3R)-3-(carbamoylamino)-N-[(1R)-1-(2-methylphenyl)ethyl]-3-thiophen-2-ylpropanamide |
| SMILES | Cc1ccccc1[C@@H](C)NC(=O)C[C@@H](NC(N)=O)c1cccs1 |
| InChI | InChI=1S/C17H21N3O2S/c1-11-6-3-4-7-13(11)12(2)19-16(21)10-14(20-17(18)22)15-8-5-9-23-15/h3-9,12,14H,10H2,1-2H3,(H,19,21)(H3,18,20,22)/t12-,14-/m1/s1 |
| InChIKey | QRCJRPCMHYNBBT-TZMCWYRMSA-N |
| XLogP | 3.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |