C18H21N3O2S — CID 94809089
(3R)-3-(carbamoylamino)-N-(1-phenylcyclobutyl)-3-thiophen-2-ylpropanamide (PubChem CID 94809089) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-N-(1-phenylcyclobutyl)-3-thiophen-2-ylpropanamide.
| Compound Name | (3R)-3-(carbamoylamino)-N-(1-phenylcyclobutyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 94809089 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (3R)-3-(carbamoylamino)-N-(1-phenylcyclobutyl)-3-thiophen-2-ylpropanamide |
| SMILES | NC(=O)N[C@H](CC(=O)NC1(c2ccccc2)CCC1)c1cccs1 |
| InChI | InChI=1S/C18H21N3O2S/c19-17(23)20-14(15-8-4-11-24-15)12-16(22)21-18(9-5-10-18)13-6-2-1-3-7-13/h1-4,6-8,11,14H,5,9-10,12H2,(H,21,22)(H3,19,20,23)/t14-/m1/s1 |
| InChIKey | RLKKTQHZDNVRCD-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |