C23H34N2OS — CID 17012416
N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]adamantane-1-carboxamide (PubChem CID 17012416) has the molecular formula C23H34N2OS and a molecular weight of 386.61 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 17012416 |
| Molecular Formula | C23H34N2OS |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCC(c1cccs1)N1CCCCCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34N2OS/c26-22(23-13-17-10-18(14-23)12-19(11-17)15-23)24-16-20(21-6-5-9-27-21)25-7-3-1-2-4-8-25/h5-6,9,17-20H,1-4,7-8,10-16H2,(H,24,26) |
| InChIKey | DHCXDGKSHZTKOB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |