C25H37N3O — CID 7496559
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]adamantane-1-carboxamide (PubChem CID 7496559) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]adamantane-1-carboxamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7496559 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]adamantane-1-carboxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C23CC4CC(CC(C4)C2)C3)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H37N3O/c1-27(2)22-7-5-21(6-8-22)23(28-9-3-4-10-28)17-26-24(29)25-14-18-11-19(15-25)13-20(12-18)16-25/h5-8,18-20,23H,3-4,9-17H2,1-2H3,(H,26,29)/t18?,19?,20?,23-,25?/m0/s1 |
| InChIKey | RCTDCXUVCRAPQL-SBTPEUDISA-N |
| XLogP | 4.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|