C20H33N3O — CID 7496200
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,3-dimethylbutanamide (PubChem CID 7496200) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 7496200 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-3,3-dimethylbutanamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)CC(C)(C)C)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H33N3O/c1-20(2,3)14-19(24)21-15-18(23-12-6-7-13-23)16-8-10-17(11-9-16)22(4)5/h8-11,18H,6-7,12-15H2,1-5H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | HKKRIQBFZMQEQO-GOSISDBHSA-N |
| XLogP | 3.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|