C21H26FN3O — CID 7496319
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2-fluorobenzamide (PubChem CID 7496319) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2-fluorobenzamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 7496319 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-2-fluorobenzamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)c2ccccc2F)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H26FN3O/c1-24(2)17-11-9-16(10-12-17)20(25-13-5-6-14-25)15-23-21(26)18-7-3-4-8-19(18)22/h3-4,7-12,20H,5-6,13-15H2,1-2H3,(H,23,26)/t20-/m0/s1 |
| InChIKey | UQRGYUGVCJKAFA-FQEVSTJZSA-N |
| XLogP | 3.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|