C27H30BrFN4O — CID 43956969
2-bromo-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]benzamide (PubChem CID 43956969) has the molecular formula C27H30BrFN4O and a molecular weight of 525.47 g/mol. Its IUPAC name is 2-bromo-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 43956969 |
| Molecular Formula | C27H30BrFN4O |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-bromo-N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]benzamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2ccccc2Br)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H30BrFN4O/c1-31(2)22-11-7-20(8-12-22)26(19-30-27(34)24-5-3-4-6-25(24)28)33-17-15-32(16-18-33)23-13-9-21(29)10-14-23/h3-14,26H,15-19H2,1-2H3,(H,30,34) |
| InChIKey | JHCWOFZVYBHEKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|