C16H27N3O2S — CID 111454012
1-(4-hydroxy-3-methylbutan-2-yl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea (PubChem CID 111454012) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylbutan-2-yl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(4-hydroxy-3-methylbutan-2-yl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 111454012 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-(4-hydroxy-3-methylbutan-2-yl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
| SMILES | CC(CO)C(C)NC(=O)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C16H27N3O2S/c1-12(11-20)13(2)18-16(21)17-10-14(15-6-5-9-22-15)19-7-3-4-8-19/h5-6,9,12-14,20H,3-4,7-8,10-11H2,1-2H3,(H2,17,18,21) |
| InChIKey | HABPKIQMXLLZBB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |