C17H27N3O2S — CID 100840537
1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea (PubChem CID 100840537) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 100840537 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea |
| SMILES | C[C@H](NC(=O)NC[C@H](c1cccs1)N1CCCC1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H27N3O2S/c1-13(15-6-4-10-22-15)19-17(21)18-12-14(16-7-5-11-23-16)20-8-2-3-9-20/h5,7,11,13-15H,2-4,6,8-10,12H2,1H3,(H2,18,19,21)/t13-,14+,15-/m0/s1 |
| InChIKey | GCDBGZOHAAAKMN-ZNMIVQPWSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |