C15H25N3O2S — CID 95134541
1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea (PubChem CID 95134541) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 95134541 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NC[C@@H](c1cccs1)N(C)C)[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H25N3O2S/c1-11(13-6-4-8-20-13)17-15(19)16-10-12(18(2)3)14-7-5-9-21-14/h5,7,9,11-13H,4,6,8,10H2,1-3H3,(H2,16,17,19)/t11-,12-,13-/m0/s1 |
| InChIKey | VSSOBIJGPGEGEH-AVGNSLFASA-N |
| XLogP | 2.22 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |