C14H25Cl2N3OS — CID 119830031
(2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]piperidine-2-carboxamide;dihydrochloride (PubChem CID 119830031) has the molecular formula C14H25Cl2N3OS and a molecular weight of 354.35 g/mol. Its IUPAC name is (2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]piperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119830031 |
| Molecular Formula | C14H25Cl2N3OS |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]piperidine-2-carboxamide;dihydrochloride |
| SMILES | CN(C)C(CNC(=O)[C@@H]1CCCCN1)c1cccs1.Cl.Cl |
| InChI | InChI=1S/C14H23N3OS.2ClH/c1-17(2)12(13-7-5-9-19-13)10-16-14(18)11-6-3-4-8-15-11;;/h5,7,9,11-12,15H,3-4,6,8,10H2,1-2H3,(H,16,18);2*1H/t11-,12?;;/m0../s1 |
| InChIKey | FMGOIBVRQWNQMH-VWTXCZJDSA-N |
| XLogP | 2.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |