C13H21N3O3S2 — CID 138005791
N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-2-sulfamoylpropanamide (PubChem CID 138005791) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-2-sulfamoylpropanamide.
| Compound Name | N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-2-sulfamoylpropanamide |
|---|---|
| PubChem CID | 138005791 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-2-sulfamoylpropanamide |
| SMILES | CC(C(=O)NCC(c1cccs1)N1CCCC1)S(N)(=O)=O |
| InChI | InChI=1S/C13H21N3O3S2/c1-10(21(14,18)19)13(17)15-9-11(12-5-4-8-20-12)16-6-2-3-7-16/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H,15,17)(H2,14,18,19) |
| InChIKey | PORLMLYIBFIFON-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |