C15H27Cl2N3O2S — CID 120502460
3-amino-2-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride (PubChem CID 120502460) has the molecular formula C15H27Cl2N3O2S and a molecular weight of 384.37 g/mol. Its IUPAC name is 3-amino-2-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride.
| Compound Name | 3-amino-2-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120502460 |
| Molecular Formula | C15H27Cl2N3O2S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-amino-2-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)butanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)NCC(c1cccs1)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C15H25N3O2S.2ClH/c1-11(12(2)16)15(19)17-10-13(14-4-3-9-21-14)18-5-7-20-8-6-18;;/h3-4,9,11-13H,5-8,10,16H2,1-2H3,(H,17,19);2*1H |
| InChIKey | DXKSZJGGHSJXHV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |