C17H25N5O2 — CID 94017524
1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 94017524) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 94017524 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1ccnc1)NC[C@@H](c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C17H25N5O2/c23-17(19-6-4-8-21-11-7-18-14-21)20-13-15(16-5-3-12-24-16)22-9-1-2-10-22/h3,5,7,11-12,14-15H,1-2,4,6,8-10,13H2,(H2,19,20,23)/t15-/m0/s1 |
| InChIKey | HZGGRIZQWFQGEB-HNNXBMFYSA-N |
| XLogP | 2.00 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|