C16H23N5OS — CID 94178888
1-(2-imidazol-1-ylethyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea (PubChem CID 94178888) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-(2-imidazol-1-ylethyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 94178888 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]urea |
| SMILES | O=C(NCCn1ccnc1)NC[C@@H](c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C16H23N5OS/c22-16(18-6-10-20-9-5-17-13-20)19-12-14(15-4-3-11-23-15)21-7-1-2-8-21/h3-5,9,11,13-14H,1-2,6-8,10,12H2,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | LCLOPRPSMPLPHU-AWEZNQCLSA-N |
| XLogP | 2.08 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |