C17H20N4O3S — CID 42912300
1-(4-nitrophenyl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea (PubChem CID 42912300) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(4-nitrophenyl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 42912300 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(4-nitrophenyl)-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N4O3S/c22-17(19-13-5-7-14(8-6-13)21(23)24)18-12-15(16-4-3-11-25-16)20-9-1-2-10-20/h3-8,11,15H,1-2,9-10,12H2,(H2,18,19,22) |
| InChIKey | RUROBHVXVYVHBR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|