C19H23N3O4S — CID 17014093
2-(4-nitrophenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide (PubChem CID 17014093) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(4-nitrophenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 17014093 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NCC(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C19H23N3O4S/c23-19(14-26-16-8-6-15(7-9-16)22(24)25)20-13-17(18-5-4-12-27-18)21-10-2-1-3-11-21/h4-9,12,17H,1-3,10-11,13-14H2,(H,20,23) |
| InChIKey | ZNWCBHDAMBKPKX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|