C22H28N4O2S — CID 71685799
1-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea (PubChem CID 71685799) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 71685799 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)Nc1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C22H28N4O2S/c27-21-9-4-12-26(21)16-17-6-3-7-18(14-17)24-22(28)23-15-19(20-8-5-13-29-20)25-10-1-2-11-25/h3,5-8,13-14,19H,1-2,4,9-12,15-16H2,(H2,23,24,28) |
| InChIKey | ZKJPNFHIQQSNHJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |