C18H23ClN4OS — CID 43004993
1-(3-chlorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea (PubChem CID 43004993) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 43004993 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea |
| SMILES | CN1CCN(C(CNC(=O)Nc2cccc(Cl)c2)c2cccs2)CC1 |
| InChI | InChI=1S/C18H23ClN4OS/c1-22-7-9-23(10-8-22)16(17-6-3-11-25-17)13-20-18(24)21-15-5-2-4-14(19)12-15/h2-6,11-12,16H,7-10,13H2,1H3,(H2,20,21,24) |
| InChIKey | ZTRQUSVZZQEKGX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |