C22H32N6OS — CID 47040363
1-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(6-piperidin-1-yl-3-pyridinyl)urea (PubChem CID 47040363) has the molecular formula C22H32N6OS and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(6-piperidin-1-yl-3-pyridinyl)urea.
| Compound Name | 1-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(6-piperidin-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 47040363 |
| Molecular Formula | C22H32N6OS |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(6-piperidin-1-yl-3-pyridinyl)urea |
| SMILES | CN1CCN(C(CNC(=O)Nc2ccc(N3CCCCC3)nc2)c2cccs2)CC1 |
| InChI | InChI=1S/C22H32N6OS/c1-26-11-13-27(14-12-26)19(20-6-5-15-30-20)17-24-22(29)25-18-7-8-21(23-16-18)28-9-3-2-4-10-28/h5-8,15-16,19H,2-4,9-14,17H2,1H3,(H2,24,25,29) |
| InChIKey | JRMMAPAAKKLINY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |