C20H27FN4OS — CID 47022400
1-[2-(4-fluorophenyl)ethyl]-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea (PubChem CID 47022400) has the molecular formula C20H27FN4OS and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 47022400 |
| Molecular Formula | C20H27FN4OS |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]urea |
| SMILES | CN1CCN(C(CNC(=O)NCCc2ccc(F)cc2)c2cccs2)CC1 |
| InChI | InChI=1S/C20H27FN4OS/c1-24-10-12-25(13-11-24)18(19-3-2-14-27-19)15-23-20(26)22-9-8-16-4-6-17(21)7-5-16/h2-7,14,18H,8-13,15H2,1H3,(H2,22,23,26) |
| InChIKey | QUANXMRMYMZZCZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |