C21H29N3OS — CID 51728290
N-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-4-phenylbutanamide (PubChem CID 51728290) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is N-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-4-phenylbutanamide.
| Compound Name | N-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 51728290 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-4-phenylbutanamide |
| SMILES | CN1CCN([C@H](CNC(=O)CCCc2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C21H29N3OS/c1-23-12-14-24(15-13-23)19(20-10-6-16-26-20)17-22-21(25)11-5-9-18-7-3-2-4-8-18/h2-4,6-8,10,16,19H,5,9,11-15,17H2,1H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | NQUASCYOMAHBIR-LJQANCHMSA-N |
| XLogP | 3.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |