C19H26N4S2 — CID 30726004
1-benzyl-3-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]thiourea (PubChem CID 30726004) has the molecular formula C19H26N4S2 and a molecular weight of 374.58 g/mol. Its IUPAC name is 1-benzyl-3-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-benzyl-3-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 30726004 |
| Molecular Formula | C19H26N4S2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-benzyl-3-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]thiourea |
| SMILES | CN1CCN([C@@H](CNC(=S)NCc2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C19H26N4S2/c1-22-9-11-23(12-10-22)17(18-8-5-13-25-18)15-21-19(24)20-14-16-6-3-2-4-7-16/h2-8,13,17H,9-12,14-15H2,1H3,(H2,20,21,24)/t17-/m0/s1 |
| InChIKey | PSKQIQYHLVGDHV-KRWDZBQOSA-N |
| XLogP | 2.70 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|