C18H23N3S2 — CID 8657230
1-(2-methylphenyl)-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]thiourea (PubChem CID 8657230) has the molecular formula C18H23N3S2 and a molecular weight of 345.54 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8657230 |
| Molecular Formula | C18H23N3S2 |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]thiourea |
| SMILES | Cc1ccccc1NC(=S)NC[C@H](c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C18H23N3S2/c1-14-7-2-3-8-15(14)20-18(22)19-13-16(17-9-6-12-23-17)21-10-4-5-11-21/h2-3,6-9,12,16H,4-5,10-11,13H2,1H3,(H2,19,20,22)/t16-/m1/s1 |
| InChIKey | UGIJPHDVJLERPK-MRXNPFEDSA-N |
| XLogP | 4.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|